InCHi String:
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1
isomeric SMILES: C[C@H](C(=O)O)N
canonical SMILES: CC(C(=O)O)N
IUPAC(2R)-2-aminopropanoic acid
PubChem Substance (SID):
85165044 213260 3433PubChem Compound (CID):
71080KEGG: Compound ID
C00133CAS Registry IDs: 338-69-2
PDB Chemical Component
ALA DALMiscellaneous Databases and IDs:
CHEBI 15570 EINECS 206-418-1
NSC 158286
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
