InCHi String:
InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1
canonical SMILES: C(C(C(C(C=O)O)O)O)OP(=O)(O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic[(2R,3S,4S)-2,3,4-trihydroxy-5-oxo-pentoxy]phosphonic acid
PubChem Substance (SID):
85165083 655036 3499PubChem Compound (CID):
77982KEGG: Compound ID
C00199CAS Registry IDs: 4151-19-3 4300-28-1
PDB Chemical Component
R51 R52Miscellaneous Databases and IDs:
ChemIDplus 004300281
EINECS 224-310-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.