InCHi String:
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1
canonical SMILES: CSCCC(C(=O)O)N
isomeric SMILES: CSCC[C@H](C(=O)O)N
PUBCHEM iupac NAME(2R)-2-amino-4-methylsulfanylbutanoic acid
PUBCHEM iupac TRADITIONAL NAME(2R)-2-amino-4-(methylthio)butyric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(2R)-2-amino-4-methylsulfanyl-butanoic acid
PUBCHEM iupac CAS NAME(2R)-2-amino-4-(methylthio)butanoic acid
PubChem Substance (SID):
85165239 8143613 24897327PubChem Compound (CID):
84815KEGG: Compound ID
C00855CAS Registry IDs: 348-67-4
PDB Chemical Component
MED METMiscellaneous Databases and IDs:
Sigma-Aldrich M9375_SIGMA
ChEBI CHEBI:16867 ChemSpider 76512
NIST Chemistry WebBook 333085030
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.