InCHi String:
InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2
isomeric and canonical SMILES: C(C(C=O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2,3-dihydroxypropanal
PubChem Substance (SID):
85165036 148791 5231PubChem Compound (CID):
751KEGG: Compound ID
C02154CAS Registry IDs: 367-47-5 56-82-6
PDB Chemical Component
3GRMiscellaneous Databases and IDs:
CHEBI 5445 NSC 67934
EINECS 206-695-9
EINECS 200-290-0
Beilstein Handbook Reference 3-01-00-03282
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.