InCHi String:
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
canonical SMILES: C(C(C(=O)O)N)C(=O)O
IUPAC: IUPAC openeye: IUPAC cas: IUPAC systematic(2S)-2-aminobutanedioic acid
IUPAC traditional(2S)-2-aminosuccinic acid
PubChem Substance (SID):
85165078 669011 3692PubChem Compound (CID):
83887KEGG: Compound ID
C00402CAS Registry IDs: 1783-96-6
PDB Chemical Component
ASP ASP_LFOHMiscellaneous Databases and IDs:
ChemIDplus 001783966
EINECS 217-234-6
Beilstein Handbook Reference 4-04-00-02998
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
