InCHi String:
InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)
canonical and isomeric SMILES: CC(C(C(=O)O)N)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME2-amino-3-methylbutanedioic acid
PUBCHEM iupac TRADITIONAL NAME2-amino-3-methyl-succinic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME2-amino-3-methyl-butanedioic acid
PubChem Substance (SID):
85165150 35029196 2898PubChem Compound (CID):
852KEGG: Compound ID n/a
CAS Registry IDs: 31571-69-4 6667-60-3
PDB Chemical Component
3MD ACBMiscellaneous Databases and IDs:
Sigma-Aldrich M6126_SIGMA
ChemIDplus 006667603
ChemSpider 13577644
BIND 1081
ChemDB 3966424
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.