InCHi String:
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)
isomeric and canonical SMILES: C(C(C(=O)O)N)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-amino-3-hydroxy-propanoic acid
PubChem Substance (SID):
85165033 209651 3982PubChem Compound (CID):
617KEGG: Compound ID
C00716CAS Registry IDs: 56-45-1 6898-95-9
PDB Chemical Component
DSN SEG SER SER_LFOH SER_LFZWMiscellaneous Databases and IDs:
CHEBI 17822 CCRIS 5422
NSC 9960
EINECS 206-130-6
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
