InCHi String:
InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1
isomeric SMILES: C1CCN[C@@H](C1)C(=O)O
canonical SMILES: C1CCNC(C1)C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2S)-piperidine-2-carboxylic acid
PubChem Substance (SID):
85165045 3698PubChem Compound (CID):
439227KEGG: Compound ID
C00408CAS Registry IDs: 3105-95-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 30913
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
