InCHi String:
InChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)
canonical and isomeric SMILES: CC(C)C(CC(=O)O)N
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-amino-4-methylpentanoic acid
PUBCHEM iupac TRADITIONAL NAME3-amino-4-methyl-valeric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME3-amino-4-methyl-pentanoic acid
PubChem Substance (SID):
85165253 24850830 770769PubChem Compound (CID):
193411KEGG: Compound ID n/a
CAS Registry IDs: 5699-54-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 17988_FLUKA
ChemIDplus 005699547
ChemSpider 167837
ChemDB 4718777
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.