InCHi String:
InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
canonical and isomeric SMILES: CS(=O)CCC(C(=O)O)N
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME2-amino-4-methylsulfinylbutanoic acid
PUBCHEM iupac TRADITIONAL NAME2-amino-4-methylsulfinyl-butyric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME2-amino-4-methylsulfinyl-butanoic acid
PubChem Substance (SID):
85165189 46508428 2890PubChem Compound (CID):
847KEGG: Compound ID n/a
CAS Registry IDs: 4241-59-2 454-41-1 62697-73-8
PDB Chemical Component
MHO SMEMiscellaneous Databases and IDs:
Sigma-Aldrich 64430_FLUKA
ChemIDplus 062697738
ChemSpider 824
EINECS 207-225-5
DrugBank DB02467
ChemDB 4116650
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.