InCHi String:
InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)
canonical and isomeric SMILES: CC(CN)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-amino-2-methylpropanoic acid
PUBCHEM iupac TRADITIONAL NAME3-amino-2-methyl-propionic acid
PUBCHEM iupac OPENEYE NAME3-amino-2-methyl-propanoic acid
PUBCHEM iupac SYSTEMATIC NAME3-azanyl-2-methyl-propanoic acid
PubChem Substance (SID):
126596868 24853033 92297538PubChem Compound (CID):
64956KEGG: Compound ID
C05145CAS Registry IDs: 144-90-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 144-90-1
MDL number MFCD00008145
Beilstein Registry Number 1720958
EC Number 205-644-8
Sigma-Aldrich 217794_ALDRICH
ChemSpider 58481
LipidMAPS LMFA01100054
NIST Chemistry WebBook 2880842530
NIST 3416055009
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.