InCHi String:
InChI=1S/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)
canonical and isomeric SMILES: C1=CC(=C(C=C1C(C(=O)O)O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME2-(3,4-dihydroxyphenyl)-2-hydroxy-acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(3,4-dihydroxyphenyl)-2-hydroxy-ethanoic acid
PubChem Substance (SID):
111677822 24849152 7906PubChem Compound (CID):
85782KEGG: Compound ID
C07470CAS Registry IDs: 775-01-9
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 151610_ALDRICH
ChEBI CHEBI:27637 NIST 2121040238
MMCD cq_04443
MDL MFCD00004231
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.