InCHi String:
InChI=1S/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)
canonical and isomeric SMILES: CCCCCCC(C(=O)O)N
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-aminooctanoic acid
PUBCHEM iupac TRADITIONAL NAME2-aminocaprylic acid
PUBCHEM iupac SYSTEMATIC NAME2-azanyloctanoic acid
PubChem Substance (SID):
126596867 24853027 85291379PubChem Compound (CID):
69522KEGG: Compound ID n/a
CAS Registry IDs: 644-90-6 2187-07-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 644-90-6
MDL number MFCD00008102
EC Number 211-424-2
Sigma-Aldrich 217700_ALDRICH
EINECS 211-424-2
LipidMAPS LMFA01100056
ChemDB 6680153
ChemIDplus 000644906
NIST Chemistry WebBook 2226804492
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.