InCHi String:
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3
canonical SMILES: CC(=O)C1=CC=CC=C1
IUPAC: IUPAC openeye: IUPAC cas: IUPAC systematic1-phenylethanone
IUPAC traditionalacetophenone
PubChem Substance (SID):
85165090 150475 9324PubChem Compound (CID):
7410KEGG: Compound ID
C07113CAS Registry IDs: 98-86-2
PDB Chemical Component
AC0Miscellaneous Databases and IDs:
ChemIDplus 000098862
EINECS 202-708-7
CCRIS 1341
HSDB 969
FEMA No. 2009
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.