InCHi String:
InChI=1S/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2
canonical and isomeric SMILES: C1C(OC2=C(C1=O)C=C(C=C2)O)C3=CC=CC=C3
PUBCHEM iupac NAME6-hydroxy-2-phenyl-2,3-dihydrochromen-4-one
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME6-hydroxy-2-phenyl-chroman-4-one
PUBCHEM iupac CAS NAME6-hydroxy-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-one
PUBCHEM iupac SYSTEMATIC NAME6-oxidanyl-2-phenyl-2,3-dihydrochromen-4-one
PubChem Substance (SID):
144080986 7847031 48421935PubChem Compound (CID):
2734580KEGG: Compound ID
C14221CAS Registry IDs: 4250-77-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 4250-77-5
MMCD cq_10062
Sigma-Aldrich 419796_ALDRICH
ChEBI CHEBI:34471 EPA DSSTox 22429
NMRShiftDB 20209224
ChEMBL CHEMBL195033
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.