InCHi String:
InChI=1S/C7H8N4S/c1-2-12-7-5-6(9-3-8-5)10-4-11-7/h3-4H,2H2,1H3,(H,8,9,10,11)
canonical and isomeric SMILES: CCSC1=NC=NC2=C1NC=N2
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME6-ethylsulfanyl-7H-purine
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac CAS NAME6-(ethylthio)-7H-purine
PubChem Substance (SID):
111677863 72794223 85485371PubChem Compound (CID):
94971KEGG: Compound ID
C14623CAS Registry IDs: 5417-84-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich E4126_SIGMA
ChEBI CHEBI:292912 ZINC ZINC00402884
MMCD cq_16293
CAS 5417-84-5
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.