InCHi String:
InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1
canonical SMILES: CC1(C(N2C(S1)C(C2=O)N)C(=O)O)C
isomeric SMILES: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)C
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME(2S,5R,6R)-6-amino-7-keto-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
PubChem Substance (SID):
85165114 592657 154380PubChem Compound (CID):
11082KEGG: Compound ID
C02954CAS Registry IDs: 1203-85-6 551-16-6
PDB Chemical Component
X1EMiscellaneous Databases and IDs:
ChemIDplus 000551166
ChEBI CHEBI:16705 ChemSpider 10611
DiscoveryGate 11082
EINECS 208-993-4
NMRShiftDB 10022987
Sigma-Aldrich 09070_FLUKA
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.