InCHi String:
InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10)
canonical and isomeric SMILES: C1=CC(=O)NC=C1C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME6-oxo-1H-pyridine-3-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME6-keto-1H-pyridine-3-carboxylic acid
PubChem Substance (SID):
85165141 24847874 10411910PubChem Compound (CID):
72924KEGG: Compound ID
C01020CAS Registry IDs: 5006-66-6 4588-15-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 128759_ALDRICH
ChEBI CHEBI:16168 ChemIDplus 005006666
ChemSpider 65756
EINECS 225-682-9
NIST 445494908
ChemDB 6680694
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.