InCHi String:
InChI=1S/C5H7N3O/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H3,6,7,8,9)
canonical and isomeric SMILES: CC1=C(NC(=O)N=C1)N
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME6-amino-5-methyl-1H-pyrimidin-2-one
PUBCHEM iupac SYSTEMATIC NAME6-azanyl-5-methyl-1H-pyrimidin-2-one
PubChem Substance (SID):
85165211 93575975 12051708PubChem Compound (CID):
65040KEGG: Compound ID
C02376CAS Registry IDs: 554-01-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChEBI CHEBI:27551 ChemSpider 13842349
BioCyc CPD0-2018
ZINC ZINC00394712
DTP/NCI 137776
NIST Chemistry WebBook 689790553
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.