InCHi String:
InChI=1S/C11H11NO3/c1-15-8-2-3-10-9(5-8)7(6-12-10)4-11(13)14/h2-3,5-6,12H,4H2,1H3,(H,13,14)
canonical and isomeric SMILES: COC1=CC2=C(C=C1)NC=C2CC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-(5-methoxy-1H-indol-3-yl)acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(5-methoxy-1H-indol-3-yl)ethanoic acid
PubChem Substance (SID):
111677832 161944 803911PubChem Compound (CID):
18986KEGG: Compound ID
M14935_ALDRICHCAS Registry IDs: 110885-75-1 3471-31-6
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich M14935_ALDRICH
ChEBI CHEBI:235589 ChemIDplus 003471316
EINECS 222-438-3
NIAID 166242
ChemDB 4559084
NIST 2380176688
MMCD cq_03186
MDL MFCD00005638
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.