InCHi String:
InChI=1S/C9H8N2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4H,1H3,(H,10,12)(H,13,14)
isomeric and canonical SMILES: CC(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic5-acetamido-2-nitro-benzoic acid
PubChem Substance (SID):
85164997 655125PubChem Compound (CID):
78076KEGG: Compound ID n/a
CAS Registry IDs: 4368-83-6
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 224-461-4
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.