InCHi String:
InChI=1S/C8H9ClN2O/c1-5(12)11-6-2-3-7(9)8(10)4-6/h2-4H,10H2,1H3,(H,11,12)
isomeric and canonical SMILES: CC(=O)NC1=CC(=C(C=C1)Cl)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeyeN-(3-amino-4-chloro-phenyl)acetamide
IUPAC systematicN-(3-amino-4-chloro-phenyl)ethanamide
PubChem Substance (SID):
85164972 681431PubChem Compound (CID):
103996KEGG: Compound ID n/a
CAS Registry IDs: 51867-83-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 257-485-9
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
