InCHi String:
InChI=1S/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)
canonical and isomeric SMILES: COC1=CC2=C(C=C1)NC=C2CC(C(=O)O)N
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid
PUBCHEM iupac TRADITIONAL NAME2-amino-3-(5-methoxy-1H-indol-3-yl)propionic acid
PUBCHEM iupac SYSTEMATIC NAME2-azanyl-3-(5-methoxy-1H-indol-3-yl)propanoic acid
PubChem Substance (SID):
144080944 29300618 114917921PubChem Compound (CID):
119802KEGG: Compound ID n/a
CAS Registry IDs: 28052-84-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 28052-84-8
MDL number MFCD00005650
Beilstein Registry Number 26781
EC Number 248-800-0
MMCD cq_17354
Sigma-Aldrich M4001_SIGMA
ChemSpider 106971
EINECS 248-800-0
NMRShiftDB 20209614
ChemIDplus 0028052848
NIST 2626330816
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.