InCHi String:
InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1
canonical SMILES: C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N
isomeric SMILES: C1=CC2=C(C=C1O)C(=CN2)C[C@@H](C(=O)O)N
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid
PUBCHEM iupac TRADITIONAL NAME(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propionic acid
PubChem Substance (SID):
85165245 3916 11076421PubChem Compound (CID):
439280KEGG: Compound ID
C00643CAS Registry IDs: 4350-09-8
PDB Chemical Component
HRPMiscellaneous Databases and IDs:
Sigma-Aldrich H9772_SIGMA
ChEBI CHEBI:17780 EPA DSSTox 5437
ChemSpider 388413
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.