InCHi String:
InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2
isomeric and canonical SMILES: C1=CC(=CC=C1CCO)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic4-(2-hydroxyethyl)phenol
PubChem Substance (SID):
85164996 153677 8315PubChem Compound (CID):
10393KEGG: Compound ID
C06044CAS Registry IDs: 501-94-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 207-930-8
NSC 59876
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.