InCHi String:
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+
isomeric and canonical SMILES: C1=CC(=CC=C1C=CC(=O)O)O
IUPAC: IUPAC cas: IUPAC openeye: IUPAC systematic3-(4-hydroxyphenyl)prop-2-enoic acid
IUPAC traditional3-(4-hydroxyphenyl)acrylic acid
PubChem Substance (SID):
111677728 166410 4069PubChem Compound (CID):
322KEGG: Compound ID
C00811CAS Registry IDs: 7400-08-0
PDB Chemical Component
HC4Miscellaneous Databases and IDs:
CHEBI 32374 EINECS 231-000-0
Beilstein Handbook Reference 4-10-00-01005
NSC 59260
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.