InCHi String:
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)
isomeric and canonical SMILES: C1=CC(=CC=C1C(=O)O)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic4-aminobenzoic acid
PubChem Substance (SID):
85164912 152180 3847PubChem Compound (CID):
978KEGG: Compound ID
C00568CAS Registry IDs: 150-13-0 8014-65-1
PDB Chemical Component
PABMiscellaneous Databases and IDs:
CHEBI 30753 NSC 7627
HSDB 6840
CCRIS 6209
Beilstein Handbook Reference 4-27-00-07875
EINECS 205-753-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.