InCHi String:
InChI=1/C11H10O3/c1-9(13)14-11-6-4-10(5-7-11)3-2-8-12/h2-8H,1H3/b3-2+
Canonical and Isomeric SMILES: CC(=O)OC1=CC=C(C=CC=O)C=C1
Beilstein4-acetoxy cinnamaldehyde
PubChem Substance (SID):
111678018PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 223
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.