bmse000264 4-Nitrophenyl phosphate at BMRB

InCHi String:
InChI=1S/C6H6NO6P/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H2,10,11,12)

canonical SMILES:
C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)O

IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic
(4-nitrophenoxy)phosphonic acid

PubChem Substance (SID):   85165070   152714   6198
PubChem Compound (CID):   378
KEGG: Compound ID   C03360
CAS Registry IDs:   32348-90-6   4264-83-9   330-13-2   54306-27-3   32348-91-7
PDB Chemical Component   4NP
Miscellaneous Databases and IDs:   ChemIDplus 000330132   EINECS 206-353-9

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.