InCHi String:
InChI=1S/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H
canonical SMILES: C1=CC(=C(C=C1[N+](=O)[O-])O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic4-nitrobenzene-1,2-diol
PubChem Substance (SID):
85165071 161710 5299PubChem Compound (CID):
1751KEGG: Compound ID
C02235CAS Registry IDs: 3316-09-4
PDB Chemical Component
4NCMiscellaneous Databases and IDs:
ChemIDplus 003316094
EINECS 222-009-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
