InCHi String:
InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)
canonical and isomeric SMILES: CC(C)CC(=O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME4-methyl-2-oxopentanoic acid
PUBCHEM iupac TRADITIONAL NAME2-keto-4-methyl-valeric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME4-methyl-2-oxo-pentanoic acid
PubChem Substance (SID):
85165177 10342986 24438451PubChem Compound (CID):
70KEGG: Compound ID
C00233CAS Registry IDs: 4502-00-5 816-66-0 51828-95-6
PDB Chemical Component
COIMiscellaneous Databases and IDs:
Sigma-Aldrich 68255_FLUKA
ChemIDplus 000816660
DrugBank DB03229
ChemSpider 69
EINECS 212-435-5
ChemDB 6691046
NIST 293888292
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.