InCHi String:
InChI=1/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+/f/h11H
Canonical and Isomeric SMILES: COC1=CC=C(C=C1)C=CC(O)=O
Beilstein4-Methoxycinnamic acid
PubChem Substance (SID):
111678052PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 49
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
