InCHi String:
InChI=1/C9H12O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7,10H,1-2H3
Canonical and Isomeric SMILES: CC(C1=CC=C(C=C1)OC)O
Beilstein4-Methoxy benzyl alcohol
PubChem Substance (SID):
111678010PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 209
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
