InCHi String:
InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H
canonical SMILES: C1=CC(=CC=C1C=O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic4-hydroxybenzaldehyde
PubChem Substance (SID):
111677737 173279 3906PubChem Compound (CID):
126KEGG: Compound ID
C00633CAS Registry IDs: 123-08-0
PDB Chemical Component
HBAMiscellaneous Databases and IDs:
ChemIDplus 000123080
EINECS 204-599-1
Beilstein Handbook Reference 4-08-00-00251
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.