InCHi String:
InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+
canonical SMILES: COC1=C(C=CC(=C1)C=CC=O)O
isomeric SMILES: COC1=C(C=CC(=C1)\C=C\C=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enal
PUBCHEM iupac TRADITIONAL NAME(E)-3-(4-hydroxy-3-methoxy-phenyl)acrolein
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(4-hydroxy-3-methoxy-phenyl)prop-2-enal
PubChem Substance (SID):
111677741 8143515 39289633PubChem Compound (CID):
5280536KEGG: Compound ID
C02666CAS Registry IDs: 458-36-6
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 382051_ALDRICH
ChEBI CHEBI:16547 ChemSpider 4444167
NMRShiftDB 20040739
CambridgeSoft Corporation 1815
NIST Chemistry WebBook 469449989
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.