Wikipedia:  

3-methyladipic acid

(+)-3-Methylhexanedioic acid; (R)-(+)-3-Methyladipic acid
Molecular Formula
C7 H12 O4
Natural Isotopic Abundance Mass
160.16778
Mono-Isotopic Molecular Masses
C12N14:   160.0735588736
C13N14:   167.0970427382
C12N15:   160.0735588736
C13N15:   167.0970427382
3-methyladipic acid image
3-methyladipic acid
InCHi String:
InChI=1S/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/t5-/m1/s1

canonical SMILES:
CC(CCC(=O)O)CC(=O)O
isomeric SMILES:
C[C@H](CCC(=O)O)CC(=O)O


PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME
(3R)-3-methylhexanedioic acid

PUBCHEM iupac TRADITIONAL NAME
(3R)-3-methyladipic acid



PubChem Substance (SID):   111677762   30082025   24896759
PubChem Compound (CID):   2723701
KEGG: Compound ID   M27387_ALDRICH
CAS Registry IDs:   n/a
PDB Chemical Component   n/a
Miscellaneous Databases and IDs:   Sigma-Aldrich M27387_ALDRICH   ChemSpider 2005900   MMCD cq_10685   MDL MFCD00063200

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.