InCHi String:
InChI=1S/C8H8O4/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)
canonical and isomeric SMILES: C1=CC(=CC(=C1)O)C(C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-hydroxy-2-(3-hydroxyphenyl)acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-hydroxy-2-(3-hydroxyphenyl)ethanoic acid
PubChem Substance (SID):
85165353 663806 24879178PubChem Compound (CID):
86957KEGG: Compound ID n/a
CAS Registry IDs: 17119-15-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 55520_FLUKA
ChemIDplus 017119152
EINECS 241-182-3
ChemDB 6046659
NIST 3320276251
MMCD cq_10776
MDL MFCD00042723
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.