InCHi String:
InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)
isomeric and canonical SMILES: CC(CC(=O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic3-hydroxybutanoic acid
PubChem Substance (SID):
85164987 152509PubChem Compound (CID):
441KEGG: Compound ID n/a
CAS Registry IDs: 300-85-6 625-71-8
PDB Chemical Component
3HLMiscellaneous Databases and IDs:
EINECS 210-908-0
EINECS 206-099-9
NSC 3806
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
