InCHi String:
InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+
canonical SMILES: COC1=C(C=C(C=C1)C=CC(=O)O)O
isomeric SMILES: COC1=C(C=C(C=C1)/C=C/C(=O)O)O
PUBCHEM iupac NAME(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(E)-3-(3-hydroxy-4-methoxy-phenyl)acrylic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoic acid
PUBCHEM iupac CAS NAME(E)-3-(3-hydroxy-4-methoxyphenyl)-2-propenoic acid
PubChem Substance (SID):
111677761 24846591 12653PubChem Compound (CID):
736186KEGG: Compound ID
C10470CAS Registry IDs: 537-73-5
PDB Chemical Component
4FEMiscellaneous Databases and IDs:
Sigma-Aldrich 103012_ALDRICH
NIST 4188758742
MMCD cq_07135
MDL MFCD00004391
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.