InCHi String:
InChI=1S/C8H9BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5,11-12H,1H3
canonical and isomeric SMILES: B(C1=CC(=CC=C1)C(=O)C)(O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME(3-acetylphenyl)boronic acid
PUBCHEM iupac SYSTEMATIC NAME(3-ethanoylphenyl)boronic acid
PubChem Substance (SID):
144080961 84981617 24870685PubChem Compound (CID):
2734310KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 204841-19-0
MMCD cq_10494
MDL number MFCD01074678
Sigma-Aldrich 470813_ALDRICH
NMRShiftDB 20208061
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.