InCHi String:
InChI=1S/C4H8N2O3/c5-4(9)6-2-1-3(7)8/h1-2H2,(H,7,8)(H3,5,6,9)
canonical and isomeric SMILES: C(CNC(=O)N)C(=O)O
PUBCHEM iupac NAME3-(carbamoylamino)propanoic acid
PUBCHEM iupac TRADITIONAL NAME3-ureidopropionic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME3-ureidopropanoic acid
PUBCHEM iupac SYSTEMATIC NAME3-(aminocarbonylamino)propanoic acid
PubChem Substance (SID):
85165133 5621 26737998PubChem Compound (CID):
111KEGG: Compound ID
C02642CAS Registry IDs: 462-88-4
PDB Chemical Component
URPMiscellaneous Databases and IDs:
Thomson Pharma 00067291
ChemIDplus 000462884
ChEBI CHEBI:18261 ChemSpider 109
DTP/NCI 190691
Sigma-Aldrich 94295_FLUKA
MMDB 59805.9
ChemDB 3999496
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.