InCHi String:
InChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)
canonical and isomeric SMILES: CCC(C)C(=O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-methyl-2-oxopentanoic acid
PUBCHEM iupac TRADITIONAL NAME2-keto-3-methyl-valeric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME3-methyl-2-oxo-pentanoic acid
PubChem Substance (SID):
6284 24854807 1953PubChem Compound (CID):
47KEGG: Compound ID
C03465CAS Registry IDs: 3715-31-9 1460-34-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 215-955-0
Thomson Pharma 00428195
ChemIDplus 001460340
Sigma-Aldrich 246468_ALDRICH
ChemDB 6048275
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.