InCHi String:
InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13)
canonical SMILES: C1=CC(=CC=C1CC(=O)C(=O)O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic3-(4-hydroxyphenyl)-2-oxo-propanoic acid
PubChem Substance (SID):
85165068 152264 4406PubChem Compound (CID):
979KEGG: Compound ID
C01179CAS Registry IDs: 156-39-8
PDB Chemical Component
ENOMiscellaneous Databases and IDs:
ChemIDplus 000156398
EINECS 205-852-9
Beilstein Handbook Reference 4-10-00-03630
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.