InCHi String:
InChI=1S/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3
Canonical and Isomeric SMILES: COC1=C(C=C(C=C1)CO)OC
Beilstein3,4-Dimethoxybenzyl alcohol
PubChem Substance (SID):
111677930PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 5
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
