InCHi String:
InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1
canonical SMILES: C1=CC(=C(C=C1CC(C(=O)O)N)O)O
isomeric SMILES: C1=CC(=C(C=C1C[C@@H](C(=O)O)N)O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid
PUBCHEM iupac TRADITIONAL NAME(2S)-2-amino-3-(3,4-dihydroxyphenyl)propionic acid
PubChem Substance (SID):
85165122 11112155 26746620PubChem Compound (CID):
6047KEGG: Compound ID
D00059CAS Registry IDs: 59-92-7
PDB Chemical Component
DAH TY3Miscellaneous Databases and IDs:
Thomson Pharma 00036711
ChEBI CHEBI:15765 ChemSpider 5824
NCGC NCGC00016270-01
Sigma-Aldrich D9628_SIGMA
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.