Wikipedia:  

3,4,5-trimethoxy cinnamic acid

3,4,5-trimethoxy cinnamic acid
Molecular Formula
C12 H14 O5
Natural Isotopic Abundance Mass
238.23656
Mono-Isotopic Molecular Masses
C12N14:   238.0841235599
C13N14:   250.1243816135
C12N15:   238.0841235599
C13N15:   250.1243816135
3,4,5-trimethoxy cinnamic acid image
3,4,5-trimethoxy cinnamic acid
InCHi String:
InChI=1/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b5-4+/f/h13H

Canonical and Isomeric SMILES:
COC1=C(C(=CC(=C1)C=CC(O)=O)OC)OC


Beilstein
3,4,5-trimethoxy cinnamic acid



PubChem Substance (SID):   111678060
PubChem Compound (CID):   n/a
KEGG: Compound ID   n/a
CAS Registry IDs:   n/a
PDB Chemical Component   n/a
NMR Lignin Database 63
Miscellaneous Databases and IDs:   n/a

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.