InCHi String:
InChI=1S/C11H8O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13)
canonical and isomeric SMILES: C1=CC=C2C=C(C=CC2=C1)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAMEnaphthalene-2-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME2-naphthoic acid
PUBCHEM iupac CAS NAME2-naphthalenecarboxylic acid
PubChem Substance (SID):
111677831 5788142 10432674PubChem Compound (CID):
7123KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 180246_ALDRICH
ChemSpider 11438727
ChemDB 5080861
NIST Chemistry WebBook 4281060752
NIST 4281060752
MMCD cq_09945
MDL MFCD00004101
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.