InCHi String:
InChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11)
canonical and isomeric SMILES: C1=CC=C(C(=C1)CC(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-(2-hydroxyphenyl)acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(2-hydroxyphenyl)ethanoic acid
PubChem Substance (SID):
111677847 10529849 24895662PubChem Compound (CID):
11970KEGG: Compound ID
C05852CAS Registry IDs: 614-75-5
PDB Chemical Component
OHPMiscellaneous Databases and IDs:
Sigma-Aldrich H49804_ALDRICH
NMRShiftDB 10008771
NIST Chemistry WebBook 3011688727
NIST 3011688727
MMCD cq_03293
MDL MFCD00004323
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.