InCHi String:
InChI=1S/C9H10O4/c10-5-6-13-9(12)7-3-1-2-4-8(7)11/h1-4,10-11H,5-6H2
canonical and isomeric SMILES: C1=CC=C(C(=C1)C(=O)OCCO)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME2-hydroxyethyl 2-hydroxybenzoate
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac CAS NAME2-hydroxybenzoic acid 2-hydroxyethyl ester
PUBCHEM iupac SYSTEMATIC NAME2-hydroxyethyl 2-oxidanylbenzoate
PubChem Substance (SID):
111677879 149883 87691507PubChem Compound (CID):
6880KEGG: Compound ID
D01557CAS Registry IDs: 87-28-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 87-28-5
MMCD cq_09318
EINECS 201-737-2
NMRShiftDB 20200174
ChemDB 6679968
ChemIDplus 000087285
NIST Chemistry WebBook 1296367682
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.