InCHi String:
InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t4-/m0/s1
canonical SMILES: CC(C)C(C(=O)O)O
isomeric SMILES: CC(C)[C@@H](C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME(2S)-2-hydroxy-3-methylbutanoic acid
PUBCHEM iupac TRADITIONAL NAME(2S)-2-hydroxy-3-methyl-butyric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(2S)-2-hydroxy-3-methyl-butanoic acid
PubChem Substance (SID):
85165350 24863611 45841649PubChem Compound (CID):
853180KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 379093_ALDRICH
ChemSpider 745606
MMCD cq_10595
MDL MFCD00066443
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.